C27H44N3O7P — CID 20624775
[3-[[1-[3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypentan-3-yl]carbamoyl]-2-methylphenyl] dihydrogen phosphate (PubChem CID 20624775) has the molecular formula C27H44N3O7P and a molecular weight of 553.64 g/mol. Its IUPAC name is [3-[[1-[3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypentan-3-yl]carbamoyl]-2-methylphenyl] dihydrogen phosphate.
| Compound Name | [3-[[1-[3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypentan-3-yl]carbamoyl]-2-methylphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 20624775 |
| Molecular Formula | C27H44N3O7P |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | [3-[[1-[3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxypentan-3-yl]carbamoyl]-2-methylphenyl] dihydrogen phosphate |
| SMILES | CCC(NC(=O)c1cccc(OP(=O)(O)O)c1C)C(O)CN1CC2CCCCC2CC1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C27H44N3O7P/c1-6-21(28-25(32)20-12-9-13-24(17(20)2)37-38(34,35)36)23(31)16-30-15-19-11-8-7-10-18(19)14-22(30)26(33)29-27(3,4)5/h9,12-13,18-19,21-23,31H,6-8,10-11,14-16H2,1-5H3,(H,28,32)(H,29,33)(H2,34,35,36) |
| InChIKey | WQEZOWIVTGBRMP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|