C38H40N4O4 — CID 20624883
[1-[[3-[[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]methyl]phenyl]methyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 20624883) has the molecular formula C38H40N4O4 and a molecular weight of 616.76 g/mol. Its IUPAC name is [1-[[3-[[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]methyl]phenyl]methyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[[3-[[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]methyl]phenyl]methyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 20624883 |
| Molecular Formula | C38H40N4O4 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | [1-[[3-[[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]methyl]phenyl]methyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CN(CCCN1C(=O)c2ccccc2C1=O)Cc1cccc(CN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C38H40N4O4/c1-40(21-10-22-42-36(43)33-16-5-6-17-34(33)37(42)44)26-28-11-9-12-29(25-28)27-41-23-19-31(20-24-41)46-38(45)39-35-18-8-7-15-32(35)30-13-3-2-4-14-30/h2-9,11-18,25,31H,10,19-24,26-27H2,1H3,(H,39,45) |
| InChIKey | YVROUMWSXTWGOD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|