C11H21F3 — CID 20625080
2,2,5,5-tetramethyl-3-(trifluoromethyl)hexane (PubChem CID 20625080) has the molecular formula C11H21F3 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-3-(trifluoromethyl)hexane.
| Compound Name | 2,2,5,5-tetramethyl-3-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 20625080 |
| Molecular Formula | C11H21F3 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2,2,5,5-tetramethyl-3-(trifluoromethyl)hexane |
| SMILES | CC(C)(C)CC(C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H21F3/c1-9(2,3)7-8(10(4,5)6)11(12,13)14/h8H,7H2,1-6H3 |
| InChIKey | YFOUHRNVZYOZJG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |