C19H29NO4 — CID 20625360
11-[(2-methoxybenzoyl)amino]undecanoic acid (PubChem CID 20625360) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 11-[(2-methoxybenzoyl)amino]undecanoic acid.
| Compound Name | 11-[(2-methoxybenzoyl)amino]undecanoic acid |
|---|---|
| PubChem CID | 20625360 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 11-[(2-methoxybenzoyl)amino]undecanoic acid |
| SMILES | COc1ccccc1C(=O)NCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H29NO4/c1-24-17-13-10-9-12-16(17)19(23)20-15-11-7-5-3-2-4-6-8-14-18(21)22/h9-10,12-13H,2-8,11,14-15H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | VRSPCTWEFVUZNN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|