C31H26F6N4O4 — CID 20625686
N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[[3-(methylamino)benzoyl]amino]phenyl]propan-2-yl]-2-hydroxyphenyl]-3-(methylamino)benzamide (PubChem CID 20625686) has the molecular formula C31H26F6N4O4 and a molecular weight of 632.56 g/mol. Its IUPAC name is N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[[3-(methylamino)benzoyl]amino]phenyl]propan-2-yl]-2-hydroxyphenyl]-3-(methylamino)benzamide.
| Compound Name | N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[[3-(methylamino)benzoyl]amino]phenyl]propan-2-yl]-2-hydroxyphenyl]-3-(methylamino)benzamide |
|---|---|
| PubChem CID | 20625686 |
| Molecular Formula | C31H26F6N4O4 |
| Molecular Weight | 632.56 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[[3-(methylamino)benzoyl]amino]phenyl]propan-2-yl]-2-hydroxyphenyl]-3-(methylamino)benzamide |
| SMILES | CNc1cccc(C(=O)Nc2cc(C(c3ccc(O)c(NC(=O)c4cccc(NC)c4)c3)(C(F)(F)F)C(F)(F)F)ccc2O)c1 |
| InChI | InChI=1S/C31H26F6N4O4/c1-38-21-7-3-5-17(13-21)27(44)40-23-15-19(9-11-25(23)42)29(30(32,33)34,31(35,36)37)20-10-12-26(43)24(16-20)41-28(45)18-6-4-8-22(14-18)39-2/h3-16,38-39,42-43H,1-2H3,(H,40,44)(H,41,45) |
| InChIKey | RYRKQQOYNQKWJT-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.56 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|