C25H36O7 — CID 20625875
tert-butyl 2-[2,4-dimethyl-4-[[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]methyl]-5-oxooxolan-2-yl]acetate (PubChem CID 20625875) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol. Its IUPAC name is tert-butyl 2-[2,4-dimethyl-4-[[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]methyl]-5-oxooxolan-2-yl]acetate.
| Compound Name | tert-butyl 2-[2,4-dimethyl-4-[[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]methyl]-5-oxooxolan-2-yl]acetate |
|---|---|
| PubChem CID | 20625875 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | tert-butyl 2-[2,4-dimethyl-4-[[4-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2,5-dioxooxolan-3-yl]methyl]-5-oxooxolan-2-yl]acetate |
| SMILES | CC1C2CCC(C2)C1C1C(=O)OC(=O)C1CC1(C)CC(C)(CC(=O)OC(C)(C)C)OC1=O |
| InChI | InChI=1S/C25H36O7/c1-13-14-7-8-15(9-14)18(13)19-16(20(27)30-21(19)28)10-24(5)12-25(6,32-22(24)29)11-17(26)31-23(2,3)4/h13-16,18-19H,7-12H2,1-6H3 |
| InChIKey | NLRXKEGWVIIOOH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|