About 2-(3-methylbutyl)-1,2-thiazolidin-3-one
2-(3-methylbutyl)-1,2-thiazolidin-3-one (PubChem CID 20625979) has the molecular formula C8H15NOS
and a molecular weight of 173.28 g/mol. Its IUPAC name is 2-(3-methylbutyl)-1,2-thiazolidin-3-one.
Molecular Properties
| Compound Name | 2-(3-methylbutyl)-1,2-thiazolidin-3-one |
| PubChem CID | 20625979 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 2-(3-methylbutyl)-1,2-thiazolidin-3-one |
| SMILES | CC(C)CCN1SCCC1=O |
| InChI | InChI=1S/C8H15NOS/c1-7(2)3-5-9-8(10)4-6-11-9/h7H,3-6H2,1-2H3 |
| InChIKey | RSQLLEDIVBBDSC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbutyl)-1,2-thiazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbutyl)-1,2-thiazolidin-3-one?
The IUPAC name of 2-(3-methylbutyl)-1,2-thiazolidin-3-one (CID 20625979) is 2-(3-methylbutyl)-1,2-thiazolidin-3-one.
What is the SMILES notation for 2-(3-methylbutyl)-1,2-thiazolidin-3-one?
The canonical SMILES for 2-(3-methylbutyl)-1,2-thiazolidin-3-one is CC(C)CCN1SCCC1=O.
What is the InChIKey of 2-(3-methylbutyl)-1,2-thiazolidin-3-one?
The InChIKey is RSQLLEDIVBBDSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NOS/c1-7(2)3-5-9-8(10)4-6-11-9/h7H,3-6H2,1-2H3.
What are the key properties of 2-(3-methylbutyl)-1,2-thiazolidin-3-one?
2-(3-methylbutyl)-1,2-thiazolidin-3-one has a molecular weight of 173.28 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbutyl)-1,2-thiazolidin-3-one is sourced from PubChem (CID 20625979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).