C36H44O7P2 — CID 20626083
bis(2,4,6-trimethylphenoxy)phosphoryl bis(2,4,6-trimethylphenyl) phosphate (PubChem CID 20626083) has the molecular formula C36H44O7P2 and a molecular weight of 650.69 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenoxy)phosphoryl bis(2,4,6-trimethylphenyl) phosphate.
| Compound Name | bis(2,4,6-trimethylphenoxy)phosphoryl bis(2,4,6-trimethylphenyl) phosphate |
|---|---|
| PubChem CID | 20626083 |
| Molecular Formula | C36H44O7P2 |
| Molecular Weight | 650.69 g/mol |
| Exact Mass | 650.26 |
| IUPAC Name | bis(2,4,6-trimethylphenoxy)phosphoryl bis(2,4,6-trimethylphenyl) phosphate |
| SMILES | Cc1cc(C)c(OP(=O)(Oc2c(C)cc(C)cc2C)OP(=O)(Oc2c(C)cc(C)cc2C)Oc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C36H44O7P2/c1-21-13-25(5)33(26(6)14-21)39-44(37,40-34-27(7)15-22(2)16-28(34)8)43-45(38,41-35-29(9)17-23(3)18-30(35)10)42-36-31(11)19-24(4)20-32(36)12/h13-20H,1-12H3 |
| InChIKey | BDLVEDPBRQAFKC-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.69 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|