C19H14N6 — CID 20626280
2-(4-ethynylphenyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)quinazolin-4-amine (PubChem CID 20626280) has the molecular formula C19H14N6 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-(4-ethynylphenyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)quinazolin-4-amine.
| Compound Name | 2-(4-ethynylphenyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 20626280 |
| Molecular Formula | C19H14N6 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(4-ethynylphenyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)quinazolin-4-amine |
| SMILES | C#Cc1ccc(-c2nc(Nc3n[nH]c(C)n3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C19H14N6/c1-3-13-8-10-14(11-9-13)17-21-16-7-5-4-6-15(16)18(22-17)23-19-20-12(2)24-25-19/h1,4-11H,2H3,(H2,20,21,22,23,24,25) |
| InChIKey | YHANHDRYNQELGG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|