About N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine
N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine (PubChem CID 20626410) has the molecular formula C14H19N3
and a molecular weight of 229.33 g/mol. Its IUPAC name is N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine.
Molecular Properties
| Compound Name | N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine |
| PubChem CID | 20626410 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine |
| SMILES | CC(C)Nc1nc(C(C)C)cc2cnccc12 |
| InChI | InChI=1S/C14H19N3/c1-9(2)13-7-11-8-15-6-5-12(11)14(17-13)16-10(3)4/h5-10H,1-4H3,(H,16,17) |
| InChIKey | LMIFALOWXPMRDQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine?
The IUPAC name of N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine (CID 20626410) is N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine.
What is the SMILES notation for N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine?
The canonical SMILES for N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine is CC(C)Nc1nc(C(C)C)cc2cnccc12.
What is the InChIKey of N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine?
The InChIKey is LMIFALOWXPMRDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3/c1-9(2)13-7-11-8-15-6-5-12(11)14(17-13)16-10(3)4/h5-10H,1-4H3,(H,16,17).
What are the key properties of N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine?
N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine has a molecular weight of 229.33 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-di(propan-2-yl)-2,6-naphthyridin-1-amine is sourced from PubChem (CID 20626410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).