C25H21F4N7 — CID 20626510
4-N-(7-fluoro-1H-indazol-3-yl)-6-N-[2-(methylamino)ethyl]-2-[2-(trifluoromethyl)phenyl]quinazoline-4,6-diamine (PubChem CID 20626510) has the molecular formula C25H21F4N7 and a molecular weight of 495.48 g/mol. Its IUPAC name is 4-N-(7-fluoro-1H-indazol-3-yl)-6-N-[2-(methylamino)ethyl]-2-[2-(trifluoromethyl)phenyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-(7-fluoro-1H-indazol-3-yl)-6-N-[2-(methylamino)ethyl]-2-[2-(trifluoromethyl)phenyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 20626510 |
| Molecular Formula | C25H21F4N7 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 4-N-(7-fluoro-1H-indazol-3-yl)-6-N-[2-(methylamino)ethyl]-2-[2-(trifluoromethyl)phenyl]quinazoline-4,6-diamine |
| SMILES | CNCCNc1ccc2nc(-c3ccccc3C(F)(F)F)nc(Nc3n[nH]c4c(F)cccc34)c2c1 |
| InChI | InChI=1S/C25H21F4N7/c1-30-11-12-31-14-9-10-20-17(13-14)23(34-24-16-6-4-8-19(26)21(16)35-36-24)33-22(32-20)15-5-2-3-7-18(15)25(27,28)29/h2-10,13,30-31H,11-12H2,1H3,(H2,32,33,34,35,36) |
| InChIKey | RUASXSXDDVANFV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|