C22H30Y+ — CID 20626675
bis(1,2,3,4,5-pentamethylbenzene-6-ide);yttrium(3+) (PubChem CID 20626675) has the molecular formula C22H30Y+ and a molecular weight of 383.39 g/mol. Its IUPAC name is bis(1,2,3,4,5-pentamethylbenzene-6-ide);yttrium(3+).
| Compound Name | bis(1,2,3,4,5-pentamethylbenzene-6-ide);yttrium(3+) |
|---|---|
| PubChem CID | 20626675 |
| Molecular Formula | C22H30Y+ |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | bis(1,2,3,4,5-pentamethylbenzene-6-ide);yttrium(3+) |
| SMILES | Cc1[c-]c(C)c(C)c(C)c1C.Cc1[c-]c(C)c(C)c(C)c1C.[Y+3] |
| InChI | InChI=1S/2C11H15.Y/c2*1-7-6-8(2)10(4)11(5)9(7)3;/h2*1-5H3;/q2*-1;+3 |
| InChIKey | SZDMNACUVQPVOM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|