C20H37BN6O4 — CID 20627181
CID 20627181 (PubChem CID 20627181) has the molecular formula C20H37BN6O4 and a molecular weight of 436.37 g/mol.
| Compound Name | CID 20627181 |
|---|---|
| PubChem CID | 20627181 |
| Molecular Formula | C20H37BN6O4 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | — |
| SMILES | [B]NCCCCC(NC(=O)C(N)CC(C)C)C(=O)N1CCCC1C(=O)NC(C)C(N)=O |
| InChI | InChI=1S/C20H37BN6O4/c1-12(2)11-14(22)18(29)26-15(7-4-5-9-24-21)20(31)27-10-6-8-16(27)19(30)25-13(3)17(23)28/h12-16,24H,4-11,22H2,1-3H3,(H2,23,28)(H,25,30)(H,26,29) |
| InChIKey | MJXUIYLEOOMKTD-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 159.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|