About 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol
2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol (PubChem CID 20627309) has the molecular formula C26H36O2
and a molecular weight of 380.57 g/mol. Its IUPAC name is 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol.
Molecular Properties
| Compound Name | 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol |
| PubChem CID | 20627309 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(C(c2cc(C)cc(C)c2O)C2(C)CCCCCCC2)c1 |
| InChI | InChI=1S/C26H36O2/c1-17-13-19(3)24(27)21(15-17)23(22-16-18(2)14-20(4)25(22)28)26(5)11-9-7-6-8-10-12-26/h13-16,23,27-28H,6-12H2,1-5H3 |
| InChIKey | XFHPDNKODGNQCG-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol?
The IUPAC name of 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol (CID 20627309) is 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol.
What is the SMILES notation for 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol?
The canonical SMILES for 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol is Cc1cc(C)c(O)c(C(c2cc(C)cc(C)c2O)C2(C)CCCCCCC2)c1.
What is the InChIKey of 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol?
The InChIKey is XFHPDNKODGNQCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36O2/c1-17-13-19(3)24(27)21(15-17)23(22-16-18(2)14-20(4)25(22)28)26(5)11-9-7-6-8-10-12-26/h13-16,23,27-28H,6-12H2,1-5H3.
What are the key properties of 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol?
2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol has a molecular weight of 380.57 g/mol, XLogP of 7.21, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-hydroxy-3,5-dimethylphenyl)-(1-methylcyclooctyl)methyl]-4,6-dimethylphenol is sourced from PubChem (CID 20627309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).