C15H17N2O3- — CID 20627662
(11S,16R)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate (PubChem CID 20627662) has the molecular formula C15H17N2O3- and a molecular weight of 273.31 g/mol. Its IUPAC name is (11S,16R)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate.
| Compound Name | (11S,16R)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate |
|---|---|
| PubChem CID | 20627662 |
| Molecular Formula | C15H17N2O3- |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (11S,16R)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate |
| SMILES | O=C([O-])N1CC[C@H]2[C@@H](C1)c1cccc3c1N2CCOC3 |
| InChI | InChI=1S/C15H18N2O3/c18-15(19)16-5-4-13-12(8-16)11-3-1-2-10-9-20-7-6-17(13)14(10)11/h1-3,12-13H,4-9H2,(H,18,19)/p-1/t12-,13-/m0/s1 |
| InChIKey | IABPUMBVDITKKR-STQMWFEESA-M |
| XLogP | 0.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |