C22H23F3N2O2 — CID 20627684
(11R,16S)-3-[4-methoxy-2-(trifluoromethyl)phenyl]-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene (PubChem CID 20627684) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is (11R,16S)-3-[4-methoxy-2-(trifluoromethyl)phenyl]-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene.
| Compound Name | (11R,16S)-3-[4-methoxy-2-(trifluoromethyl)phenyl]-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene |
|---|---|
| PubChem CID | 20627684 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (11R,16S)-3-[4-methoxy-2-(trifluoromethyl)phenyl]-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene |
| SMILES | COc1ccc(-c2cc3c4c(c2)[C@H]2CNCC[C@H]2N4CCOC3)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F3N2O2/c1-28-15-2-3-16(19(10-15)22(23,24)25)13-8-14-12-29-7-6-27-20-4-5-26-11-18(20)17(9-13)21(14)27/h2-3,8-10,18,20,26H,4-7,11-12H2,1H3/t18-,20-/m1/s1 |
| InChIKey | UDCNRUPWCLXQES-UYAOXDASSA-N |
| XLogP | 4.18 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |