C20H19F2N3O — CID 20627690
(11R,16S)-3-(2,6-difluorophenyl)-7,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-6-one (PubChem CID 20627690) has the molecular formula C20H19F2N3O and a molecular weight of 355.39 g/mol. Its IUPAC name is (11R,16S)-3-(2,6-difluorophenyl)-7,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-6-one.
| Compound Name | (11R,16S)-3-(2,6-difluorophenyl)-7,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-6-one |
|---|---|
| PubChem CID | 20627690 |
| Molecular Formula | C20H19F2N3O |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (11R,16S)-3-(2,6-difluorophenyl)-7,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-6-one |
| SMILES | O=C1NCCN2c3c1cc(-c1c(F)cccc1F)cc3[C@H]1CNCC[C@H]12 |
| InChI | InChI=1S/C20H19F2N3O/c21-15-2-1-3-16(22)18(15)11-8-12-14-10-23-5-4-17(14)25-7-6-24-20(26)13(9-11)19(12)25/h1-3,8-9,14,17,23H,4-7,10H2,(H,24,26)/t14-,17-/m1/s1 |
| InChIKey | NIIRIYFOZXLRGP-RHSMWYFYSA-N |
| XLogP | 2.64 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |