C50H62N2O5Si — CID 20627805
benzyl 4-[(2R)-2-[[benzyl-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]amino]methyl]-3,4-dihydro-2H-chromen-6-yl]-2-(butylamino)benzoate (PubChem CID 20627805) has the molecular formula C50H62N2O5Si and a molecular weight of 799.14 g/mol. Its IUPAC name is benzyl 4-[(2R)-2-[[benzyl-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]amino]methyl]-3,4-dihydro-2H-chromen-6-yl]-2-(butylamino)benzoate.
| Compound Name | benzyl 4-[(2R)-2-[[benzyl-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]amino]methyl]-3,4-dihydro-2H-chromen-6-yl]-2-(butylamino)benzoate |
|---|---|
| PubChem CID | 20627805 |
| Molecular Formula | C50H62N2O5Si |
| Molecular Weight | 799.14 g/mol |
| Exact Mass | 798.44 |
| IUPAC Name | benzyl 4-[(2R)-2-[[benzyl-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]amino]methyl]-3,4-dihydro-2H-chromen-6-yl]-2-(butylamino)benzoate |
| SMILES | CCCCNc1cc(-c2ccc3c(c2)CC[C@H](CN(Cc2ccccc2)C[C@@H](COc2ccccc2)O[Si](C)(C)C(C)(C)C)O3)ccc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C50H62N2O5Si/c1-7-8-30-51-47-32-41(25-28-46(47)49(53)55-36-39-20-14-10-15-21-39)40-26-29-48-42(31-40)24-27-44(56-48)34-52(33-38-18-12-9-13-19-38)35-45(57-58(5,6)50(2,3)4)37-54-43-22-16-11-17-23-43/h9-23,25-26,28-29,31-32,44-45,51H,7-8,24,27,30,33-37H2,1-6H3/t44-,45+/m1/s1 |
| InChIKey | PXWLZXAGLLHUJJ-UVTBUIGASA-N |
| XLogP | 11.59 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.14 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|