C10H12NOY+2 — CID 20627839
2,3,4,6-tetrahydrochromen-6-id-2-ylmethanamine;yttrium(3+) (PubChem CID 20627839) has the molecular formula C10H12NOY+2 and a molecular weight of 251.12 g/mol. Its IUPAC name is 2,3,4,6-tetrahydrochromen-6-id-2-ylmethanamine;yttrium(3+).
| Compound Name | 2,3,4,6-tetrahydrochromen-6-id-2-ylmethanamine;yttrium(3+) |
|---|---|
| PubChem CID | 20627839 |
| Molecular Formula | C10H12NOY+2 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 2,3,4,6-tetrahydrochromen-6-id-2-ylmethanamine;yttrium(3+) |
| SMILES | NCC1CCc2c[c-]ccc2O1.[Y+3] |
| InChI | InChI=1S/C10H12NO.Y/c11-7-9-6-5-8-3-1-2-4-10(8)12-9;/h2-4,9H,5-7,11H2;/q-1;+3 |
| InChIKey | ZUECVEROYHGQLW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|