About 2,3,4-trideuterioquinoline
2,3,4-trideuterioquinoline (PubChem CID 20628621) has the molecular formula C9H7N
and a molecular weight of 132.18 g/mol. Its IUPAC name is 2,3,4-trideuterioquinoline.
Molecular Properties
| Compound Name | 2,3,4-trideuterioquinoline |
| PubChem CID | 20628621 |
| Molecular Formula | C9H7N |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 2,3,4-trideuterioquinoline |
| SMILES | [2H]c1nc2ccccc2c([2H])c1[2H] |
| InChI | InChI=1S/C9H7N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7H/i3D,5D,7D |
| InChIKey | SMWDFEZZVXVKRB-YOOLLTNUSA-N |
| XLogP | 2.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4-trideuterioquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trideuterioquinoline?
The IUPAC name of 2,3,4-trideuterioquinoline (CID 20628621) is 2,3,4-trideuterioquinoline.
What is the SMILES notation for 2,3,4-trideuterioquinoline?
The canonical SMILES for 2,3,4-trideuterioquinoline is [2H]c1nc2ccccc2c([2H])c1[2H].
What is the InChIKey of 2,3,4-trideuterioquinoline?
The InChIKey is SMWDFEZZVXVKRB-YOOLLTNUSA-N. The full InChI is InChI=1S/C9H7N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7H/i3D,5D,7D.
What are the key properties of 2,3,4-trideuterioquinoline?
2,3,4-trideuterioquinoline has a molecular weight of 132.18 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trideuterioquinoline is sourced from PubChem (CID 20628621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).