About N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide
N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide (PubChem CID 20629401) has the molecular formula C20H32FN3O4S
and a molecular weight of 429.56 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide |
| PubChem CID | 20629401 |
| Molecular Formula | C20H32FN3O4S |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide |
| SMILES | CC1CN(c2cc(F)ccc2NC(=O)CCCCNS(=O)(=O)C(C)C)CC(C)O1 |
| InChI | InChI=1S/C20H32FN3O4S/c1-14(2)29(26,27)22-10-6-5-7-20(25)23-18-9-8-17(21)11-19(18)24-12-15(3)28-16(4)13-24/h8-9,11,14-16,22H,5-7,10,12-13H2,1-4H3,(H,23,25) |
| InChIKey | XPWADDLYQQXUGG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide?
The IUPAC name of N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide (CID 20629401) is N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide.
What is the SMILES notation for N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide?
The canonical SMILES for N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide is CC1CN(c2cc(F)ccc2NC(=O)CCCCNS(=O)(=O)C(C)C)CC(C)O1.
What is the InChIKey of N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide?
The InChIKey is XPWADDLYQQXUGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32FN3O4S/c1-14(2)29(26,27)22-10-6-5-7-20(25)23-18-9-8-17(21)11-19(18)24-12-15(3)28-16(4)13-24/h8-9,11,14-16,22H,5-7,10,12-13H2,1-4H3,(H,23,25).
What are the key properties of N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide?
N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide has a molecular weight of 429.56 g/mol, XLogP of 2.88, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]-5-(propan-2-ylsulfonylamino)pentanamide is sourced from PubChem (CID 20629401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).