About N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide
N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide (PubChem CID 20629977) has the molecular formula C22H36N2O3S
and a molecular weight of 408.61 g/mol. Its IUPAC name is N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide.
Molecular Properties
| Compound Name | N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide |
| PubChem CID | 20629977 |
| Molecular Formula | C22H36N2O3S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide |
| SMILES | CC1CCCC(c2ccc(NC(=O)CCCCNS(=O)(=O)C(C)C)cc2)C1C |
| InChI | InChI=1S/C22H36N2O3S/c1-16(2)28(26,27)23-15-6-5-10-22(25)24-20-13-11-19(12-14-20)21-9-7-8-17(3)18(21)4/h11-14,16-18,21,23H,5-10,15H2,1-4H3,(H,24,25) |
| InChIKey | VBNNTVKFBSIBBJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide?
The IUPAC name of N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide (CID 20629977) is N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide.
What is the SMILES notation for N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide?
The canonical SMILES for N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide is CC1CCCC(c2ccc(NC(=O)CCCCNS(=O)(=O)C(C)C)cc2)C1C.
What is the InChIKey of N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide?
The InChIKey is VBNNTVKFBSIBBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36N2O3S/c1-16(2)28(26,27)23-15-6-5-10-22(25)24-20-13-11-19(12-14-20)21-9-7-8-17(3)18(21)4/h11-14,16-18,21,23H,5-10,15H2,1-4H3,(H,24,25).
What are the key properties of N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide?
N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide has a molecular weight of 408.61 g/mol, XLogP of 4.66, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,3-dimethylcyclohexyl)phenyl]-5-(propan-2-ylsulfonylamino)pentanamide is sourced from PubChem (CID 20629977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).