C17H23N3O3S — CID 20630510
N-(4-cyanophenyl)-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide (PubChem CID 20630510) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(4-cyanophenyl)-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide.
| Compound Name | N-(4-cyanophenyl)-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20630510 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-(4-cyanophenyl)-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide |
| SMILES | CC(C)S(=O)(=O)NC1CCC(C(=O)Nc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C17H23N3O3S/c1-12(2)24(22,23)20-16-9-5-14(6-10-16)17(21)19-15-7-3-13(11-18)4-8-15/h3-4,7-8,12,14,16,20H,5-6,9-10H2,1-2H3,(H,19,21) |
| InChIKey | PMSUQIKYLSBLFL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |