C14H12F3NO2 — CID 2063074
2,2,2-trifluoro-N-(2-naphthalen-1-yloxyethyl)acetamide (PubChem CID 2063074) has the molecular formula C14H12F3NO2 and a molecular weight of 283.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-naphthalen-1-yloxyethyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2-naphthalen-1-yloxyethyl)acetamide |
|---|---|
| PubChem CID | 2063074 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-naphthalen-1-yloxyethyl)acetamide |
| SMILES | O=C(NCCOc1cccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO2/c15-14(16,17)13(19)18-8-9-20-12-7-3-5-10-4-1-2-6-11(10)12/h1-7H,8-9H2,(H,18,19) |
| InChIKey | VXMZYMHNHRFYRA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|