C22H24N2O5S — CID 20630833
4-(tert-butylsulfonylamino)-N-(8-ethyl-2-oxochromen-6-yl)benzamide (PubChem CID 20630833) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is 4-(tert-butylsulfonylamino)-N-(8-ethyl-2-oxochromen-6-yl)benzamide.
| Compound Name | 4-(tert-butylsulfonylamino)-N-(8-ethyl-2-oxochromen-6-yl)benzamide |
|---|---|
| PubChem CID | 20630833 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 4-(tert-butylsulfonylamino)-N-(8-ethyl-2-oxochromen-6-yl)benzamide |
| SMILES | CCc1cc(NC(=O)c2ccc(NS(=O)(=O)C(C)(C)C)cc2)cc2ccc(=O)oc12 |
| InChI | InChI=1S/C22H24N2O5S/c1-5-14-12-18(13-16-8-11-19(25)29-20(14)16)23-21(26)15-6-9-17(10-7-15)24-30(27,28)22(2,3)4/h6-13,24H,5H2,1-4H3,(H,23,26) |
| InChIKey | LWZBTXBXYMTORS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|