C45H61NO4S — CID 20631102
8-isocyano-3,13-dimethyl-8-(4-methylphenyl)sulfonyl-3,13-bis[4-(2-methylpropyl)phenyl]pentadecane-2,14-dione (PubChem CID 20631102) has the molecular formula C45H61NO4S and a molecular weight of 712.05 g/mol. Its IUPAC name is 8-isocyano-3,13-dimethyl-8-(4-methylphenyl)sulfonyl-3,13-bis[4-(2-methylpropyl)phenyl]pentadecane-2,14-dione.
| Compound Name | 8-isocyano-3,13-dimethyl-8-(4-methylphenyl)sulfonyl-3,13-bis[4-(2-methylpropyl)phenyl]pentadecane-2,14-dione |
|---|---|
| PubChem CID | 20631102 |
| Molecular Formula | C45H61NO4S |
| Molecular Weight | 712.05 g/mol |
| Exact Mass | 711.43 |
| IUPAC Name | 8-isocyano-3,13-dimethyl-8-(4-methylphenyl)sulfonyl-3,13-bis[4-(2-methylpropyl)phenyl]pentadecane-2,14-dione |
| SMILES | [C-]#[N+]C(CCCCC(C)(C(C)=O)c1ccc(CC(C)C)cc1)(CCCCC(C)(C(C)=O)c1ccc(CC(C)C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C45H61NO4S/c1-33(2)31-38-17-21-40(22-18-38)43(8,36(6)47)27-11-13-29-45(46-10,51(49,50)42-25-15-35(5)16-26-42)30-14-12-28-44(9,37(7)48)41-23-19-39(20-24-41)32-34(3)4/h15-26,33-34H,11-14,27-32H2,1-9H3 |
| InChIKey | MAAIUWDFJYYXEH-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.05 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|