C39H49NO4S — CID 20631165
8-isocyano-3,13-dimethyl-3,13-bis(4-methylphenyl)-8-(4-methylphenyl)sulfonylpentadecane-2,14-dione (PubChem CID 20631165) has the molecular formula C39H49NO4S and a molecular weight of 627.89 g/mol. Its IUPAC name is 8-isocyano-3,13-dimethyl-3,13-bis(4-methylphenyl)-8-(4-methylphenyl)sulfonylpentadecane-2,14-dione.
| Compound Name | 8-isocyano-3,13-dimethyl-3,13-bis(4-methylphenyl)-8-(4-methylphenyl)sulfonylpentadecane-2,14-dione |
|---|---|
| PubChem CID | 20631165 |
| Molecular Formula | C39H49NO4S |
| Molecular Weight | 627.89 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | 8-isocyano-3,13-dimethyl-3,13-bis(4-methylphenyl)-8-(4-methylphenyl)sulfonylpentadecane-2,14-dione |
| SMILES | [C-]#[N+]C(CCCCC(C)(C(C)=O)c1ccc(C)cc1)(CCCCC(C)(C(C)=O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C39H49NO4S/c1-29-13-19-34(20-14-29)37(6,32(4)41)25-9-11-27-39(40-8,45(43,44)36-23-17-31(3)18-24-36)28-12-10-26-38(7,33(5)42)35-21-15-30(2)16-22-35/h13-24H,9-12,25-28H2,1-7H3 |
| InChIKey | HLUSTIQTAPUHCP-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.89 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|