C21H22N2O5 — CID 20631523
5-ethenyl-2-[2-methoxycarbonyl-6-(2-methylpropylcarbamoyl)-3-pyridinyl]benzoic acid (PubChem CID 20631523) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-ethenyl-2-[2-methoxycarbonyl-6-(2-methylpropylcarbamoyl)-3-pyridinyl]benzoic acid.
| Compound Name | 5-ethenyl-2-[2-methoxycarbonyl-6-(2-methylpropylcarbamoyl)-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 20631523 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 5-ethenyl-2-[2-methoxycarbonyl-6-(2-methylpropylcarbamoyl)-3-pyridinyl]benzoic acid |
| SMILES | C=Cc1ccc(-c2ccc(C(=O)NCC(C)C)nc2C(=O)OC)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H22N2O5/c1-5-13-6-7-14(16(10-13)20(25)26)15-8-9-17(19(24)22-11-12(2)3)23-18(15)21(27)28-4/h5-10,12H,1,11H2,2-4H3,(H,22,24)(H,25,26) |
| InChIKey | SDOULTNJLFQSDT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |