About 2-ethyl-3-methoxy-4,5,6-trimethyloxane
2-ethyl-3-methoxy-4,5,6-trimethyloxane (PubChem CID 20632118) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-ethyl-3-methoxy-4,5,6-trimethyloxane.
Molecular Properties
| Compound Name | 2-ethyl-3-methoxy-4,5,6-trimethyloxane |
| PubChem CID | 20632118 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-ethyl-3-methoxy-4,5,6-trimethyloxane |
| SMILES | CCC1OC(C)C(C)C(C)C1OC |
| InChI | InChI=1S/C11H22O2/c1-6-10-11(12-5)8(3)7(2)9(4)13-10/h7-11H,6H2,1-5H3 |
| InChIKey | LWPRLFXIDFVCRE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-3-methoxy-4,5,6-trimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-methoxy-4,5,6-trimethyloxane?
The IUPAC name of 2-ethyl-3-methoxy-4,5,6-trimethyloxane (CID 20632118) is 2-ethyl-3-methoxy-4,5,6-trimethyloxane.
What is the SMILES notation for 2-ethyl-3-methoxy-4,5,6-trimethyloxane?
The canonical SMILES for 2-ethyl-3-methoxy-4,5,6-trimethyloxane is CCC1OC(C)C(C)C(C)C1OC.
What is the InChIKey of 2-ethyl-3-methoxy-4,5,6-trimethyloxane?
The InChIKey is LWPRLFXIDFVCRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-6-10-11(12-5)8(3)7(2)9(4)13-10/h7-11H,6H2,1-5H3.
What are the key properties of 2-ethyl-3-methoxy-4,5,6-trimethyloxane?
2-ethyl-3-methoxy-4,5,6-trimethyloxane has a molecular weight of 186.29 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-methoxy-4,5,6-trimethyloxane is sourced from PubChem (CID 20632118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).