C34H45F9O4 — CID 20632173
[(2S)-octan-2-yl] 6-[4-(5,5,6,6,7,7,8,8,8-nonafluorooctyl)cyclohexanecarbonyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 20632173) has the molecular formula C34H45F9O4 and a molecular weight of 688.71 g/mol. Its IUPAC name is [(2S)-octan-2-yl] 6-[4-(5,5,6,6,7,7,8,8,8-nonafluorooctyl)cyclohexanecarbonyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [(2S)-octan-2-yl] 6-[4-(5,5,6,6,7,7,8,8,8-nonafluorooctyl)cyclohexanecarbonyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 20632173 |
| Molecular Formula | C34H45F9O4 |
| Molecular Weight | 688.71 g/mol |
| Exact Mass | 688.32 |
| IUPAC Name | [(2S)-octan-2-yl] 6-[4-(5,5,6,6,7,7,8,8,8-nonafluorooctyl)cyclohexanecarbonyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCC[C@H](C)OC(=O)C1CCc2cc(OC(=O)C3CCC(CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC3)ccc2C1 |
| InChI | InChI=1S/C34H45F9O4/c1-3-4-5-6-9-22(2)46-30(45)27-16-15-26-21-28(18-17-25(26)20-27)47-29(44)24-13-11-23(12-14-24)10-7-8-19-31(35,36)32(37,38)33(39,40)34(41,42)43/h17-18,21-24,27H,3-16,19-20H2,1-2H3/t22-,23?,24?,27?/m0/s1 |
| InChIKey | PBQFUOFKGABYFX-DKIQPJTHSA-N |
| XLogP | 10.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.71 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|