About sulfonyloxidanium
sulfonyloxidanium (PubChem CID 20632473) has the molecular formula HO3S+
and a molecular weight of 81.07 g/mol. Its IUPAC name is sulfonyloxidanium.
Molecular Properties
| Compound Name | sulfonyloxidanium |
|---|
| PubChem CID | 20632473 |
|---|
| Molecular Formula | HO3S+ |
|---|
| Molecular Weight | 81.07 g/mol |
|---|
| Exact Mass | 80.96 |
|---|
| IUPAC Name | sulfonyloxidanium |
|---|
| SMILES | O=S(=O)=[OH+] |
|---|
| InChI | InChI=1S/O3S/c1-4(2)3/p+1 |
|---|
| InChIKey | AKEJUJNQAAGONA-UHFFFAOYSA-O |
|---|
| XLogP | -0.85 |
|---|
| TPSA | 55.54 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 4 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 81.07 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze sulfonyloxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfonyloxidanium?
The IUPAC name of sulfonyloxidanium (CID 20632473) is sulfonyloxidanium.
What is the SMILES notation for sulfonyloxidanium?
The canonical SMILES for sulfonyloxidanium is O=S(=O)=[OH+].
What is the InChIKey of sulfonyloxidanium?
The InChIKey is AKEJUJNQAAGONA-UHFFFAOYSA-O. The full InChI is InChI=1S/O3S/c1-4(2)3/p+1.
What are the key properties of sulfonyloxidanium?
sulfonyloxidanium has a molecular weight of 81.07 g/mol, XLogP of -0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfonyloxidanium is sourced from PubChem (CID 20632473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).