C34H58O7 — CID 20632529
6-O-tert-butyl 4-O-methyl 2-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 10-hydroxy-3,5,7,9,9-pentamethylundec-10-ene-2,4,6-tricarboxylate (PubChem CID 20632529) has the molecular formula C34H58O7 and a molecular weight of 578.83 g/mol. Its IUPAC name is 6-O-tert-butyl 4-O-methyl 2-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 10-hydroxy-3,5,7,9,9-pentamethylundec-10-ene-2,4,6-tricarboxylate.
| Compound Name | 6-O-tert-butyl 4-O-methyl 2-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 10-hydroxy-3,5,7,9,9-pentamethylundec-10-ene-2,4,6-tricarboxylate |
|---|---|
| PubChem CID | 20632529 |
| Molecular Formula | C34H58O7 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | 6-O-tert-butyl 4-O-methyl 2-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 10-hydroxy-3,5,7,9,9-pentamethylundec-10-ene-2,4,6-tricarboxylate |
| SMILES | C=C(O)C(C)(C)CC(C)(CC(C)(CC(C)(CC)C(=O)OC1CC2CCC1(C)C2(C)C)C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H58O7/c1-15-31(10,26(37)40-24-18-23-16-17-34(24,13)30(23,8)9)20-33(12,25(36)39-14)21-32(11,19-29(6,7)22(2)35)27(38)41-28(3,4)5/h23-24,35H,2,15-21H2,1,3-14H3 |
| InChIKey | XRLCABAMUDFICV-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|