C8H8O4 — CID 20632532
4,9,11-trioxatetracyclo[5.3.1.02,6.08,10]undecan-3-one (PubChem CID 20632532) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is 4,9,11-trioxatetracyclo[5.3.1.02,6.08,10]undecan-3-one.
| Compound Name | 4,9,11-trioxatetracyclo[5.3.1.02,6.08,10]undecan-3-one |
|---|---|
| PubChem CID | 20632532 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 4,9,11-trioxatetracyclo[5.3.1.02,6.08,10]undecan-3-one |
| SMILES | O=C1OCC2C3OC(C4OC34)C12 |
| InChI | InChI=1S/C8H8O4/c9-8-3-2(1-10-8)4-6-7(12-6)5(3)11-4/h2-7H,1H2 |
| InChIKey | UAFDSOCDQRHNCL-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|