C39H62O9 — CID 20632556
5-O-tert-butyl 1-O-(6-ethoxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-5-yl) 3-O-(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 20632556) has the molecular formula C39H62O9 and a molecular weight of 674.92 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-(6-ethoxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-5-yl) 3-O-(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-tert-butyl 1-O-(6-ethoxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-5-yl) 3-O-(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20632556 |
| Molecular Formula | C39H62O9 |
| Molecular Weight | 674.92 g/mol |
| Exact Mass | 674.44 |
| IUPAC Name | 5-O-tert-butyl 1-O-(6-ethoxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-5-yl) 3-O-(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCOC1CC2COC(=O)C2CC1OC(=O)C(C)(C)CC(C)(CC(C)(CC)C(=O)OC(C)(C)C)C(=O)OC1(C)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C39H62O9/c1-11-37(8,33(42)47-35(3,4)5)22-38(9,34(43)48-39(10)19-23-16-28(39)26-15-13-14-25(23)26)21-36(6,7)32(41)46-30-18-27-24(20-45-31(27)40)17-29(30)44-12-2/h23-30H,11-22H2,1-10H3 |
| InChIKey | OBJTWRGCMGSDEI-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.92 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|