C10H22NO2S+ — CID 20632595
1,1,3-trimethyl-5-(methylsulfonylmethyl)piperidin-1-ium (PubChem CID 20632595) has the molecular formula C10H22NO2S+ and a molecular weight of 220.36 g/mol. Its IUPAC name is 1,1,3-trimethyl-5-(methylsulfonylmethyl)piperidin-1-ium.
| Compound Name | 1,1,3-trimethyl-5-(methylsulfonylmethyl)piperidin-1-ium |
|---|---|
| PubChem CID | 20632595 |
| Molecular Formula | C10H22NO2S+ |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 1,1,3-trimethyl-5-(methylsulfonylmethyl)piperidin-1-ium |
| SMILES | CC1CC(CS(C)(=O)=O)C[N+](C)(C)C1 |
| InChI | InChI=1S/C10H22NO2S/c1-9-5-10(8-14(4,12)13)7-11(2,3)6-9/h9-10H,5-8H2,1-4H3/q+1 |
| InChIKey | GGYMLCBJKJOSAJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|