C12H16N6S2 — CID 20632652
5-[4-(4-sulfanylidene-1,3,5-triazinan-1-yl)phenyl]-1,3,5-triazinane-2-thione (PubChem CID 20632652) has the molecular formula C12H16N6S2 and a molecular weight of 308.44 g/mol. Its IUPAC name is 5-[4-(4-sulfanylidene-1,3,5-triazinan-1-yl)phenyl]-1,3,5-triazinane-2-thione.
| Compound Name | 5-[4-(4-sulfanylidene-1,3,5-triazinan-1-yl)phenyl]-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 20632652 |
| Molecular Formula | C12H16N6S2 |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-[4-(4-sulfanylidene-1,3,5-triazinan-1-yl)phenyl]-1,3,5-triazinane-2-thione |
| SMILES | S=C1NCN(c2ccc(N3CNC(=S)NC3)cc2)CN1 |
| InChI | InChI=1S/C12H16N6S2/c19-11-13-5-17(6-14-11)9-1-2-10(4-3-9)18-7-15-12(20)16-8-18/h1-4H,5-8H2,(H2,13,14,19)(H2,15,16,20) |
| InChIKey | NZLVEFRZCBQOKQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|