C11H22N6S2 — CID 20632656
5-methyl-4-[3-(1-methyl-4-sulfanylidene-1,3,5-triazinan-2-yl)propyl]-1,3,5-triazinane-2-thione (PubChem CID 20632656) has the molecular formula C11H22N6S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 5-methyl-4-[3-(1-methyl-4-sulfanylidene-1,3,5-triazinan-2-yl)propyl]-1,3,5-triazinane-2-thione.
| Compound Name | 5-methyl-4-[3-(1-methyl-4-sulfanylidene-1,3,5-triazinan-2-yl)propyl]-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 20632656 |
| Molecular Formula | C11H22N6S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-methyl-4-[3-(1-methyl-4-sulfanylidene-1,3,5-triazinan-2-yl)propyl]-1,3,5-triazinane-2-thione |
| SMILES | CN1CNC(=S)NC1CCCC1NC(=S)NCN1C |
| InChI | InChI=1S/C11H22N6S2/c1-16-6-12-10(18)14-8(16)4-3-5-9-15-11(19)13-7-17(9)2/h8-9H,3-7H2,1-2H3,(H2,12,14,18)(H2,13,15,19) |
| InChIKey | VRRVAUKXSRYKMK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|