C16H18N2O5 — CID 20632716
ethyl 2-[3-(2,5-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]acetate (PubChem CID 20632716) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is ethyl 2-[3-(2,5-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]acetate.
| Compound Name | ethyl 2-[3-(2,5-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]acetate |
|---|---|
| PubChem CID | 20632716 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | ethyl 2-[3-(2,5-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)CC(=O)N(c2cc(C)ccc2C)C1=O |
| InChI | InChI=1S/C16H18N2O5/c1-4-23-15(21)9-17-13(19)8-14(20)18(16(17)22)12-7-10(2)5-6-11(12)3/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | YAXKFPBEJOJKJY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|