C33H56O4 — CID 20632879
2-methyl-4-[[(2R)-5,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl]oxy]butanoic acid (PubChem CID 20632879) has the molecular formula C33H56O4 and a molecular weight of 516.81 g/mol. Its IUPAC name is 2-methyl-4-[[(2R)-5,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl]oxy]butanoic acid.
| Compound Name | 2-methyl-4-[[(2R)-5,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 20632879 |
| Molecular Formula | C33H56O4 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.42 |
| IUPAC Name | 2-methyl-4-[[(2R)-5,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl]oxy]butanoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1OCCC(C)C(=O)O)CC[C@@H](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C33H56O4/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-29-18-19-30-28(8)31(26(6)27(7)32(30)37-29)36-21-20-25(5)33(34)35/h22-25,29H,9-21H2,1-8H3,(H,34,35)/t23-,24-,25?,29-/m1/s1 |
| InChIKey | TZQJOJLBHDYPSF-WBDGXPASSA-N |
| XLogP | 9.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |