C19H24O6 — CID 20632883
2-[[2-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]acetic acid (PubChem CID 20632883) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[[2-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]acetic acid.
| Compound Name | 2-[[2-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 20632883 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-[[2-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]acetic acid |
| SMILES | COC(=O)/C=C/C1(C)CCc2c(C)c(OCC(=O)O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C19H24O6/c1-11-12(2)18-14(13(3)17(11)24-10-15(20)21)6-8-19(4,25-18)9-7-16(22)23-5/h7,9H,6,8,10H2,1-5H3,(H,20,21)/b9-7+ |
| InChIKey | ZPHCLJTZYJPPAR-VQHVLOKHSA-N |
| XLogP | 2.89 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|