C24H27BClN5O — CID 20633168
[4-[13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-methylborinic acid (PubChem CID 20633168) has the molecular formula C24H27BClN5O and a molecular weight of 447.78 g/mol. Its IUPAC name is [4-[13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-methylborinic acid.
| Compound Name | [4-[13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 20633168 |
| Molecular Formula | C24H27BClN5O |
| Molecular Weight | 447.78 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [4-[13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCN(C2c3ccc(Cl)cc3C(Cn3ccnc3C)=Cc3cccnc32)CC1 |
| InChI | InChI=1S/C24H27BClN5O/c1-17-27-8-9-30(17)16-19-14-18-4-3-7-28-23(18)24(21-6-5-20(26)15-22(19)21)29-10-12-31(13-11-29)25(2)32/h3-9,14-15,24,32H,10-13,16H2,1-2H3 |
| InChIKey | WOTZDQHYBLIAIF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.78 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|