C13H13N3OS — CID 20633244
2-butyl-5-oxido-[1,3]thiazolo[4,5-c][1,5]naphthyridin-5-ium (PubChem CID 20633244) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-butyl-5-oxido-[1,3]thiazolo[4,5-c][1,5]naphthyridin-5-ium.
| Compound Name | 2-butyl-5-oxido-[1,3]thiazolo[4,5-c][1,5]naphthyridin-5-ium |
|---|---|
| PubChem CID | 20633244 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-butyl-5-oxido-[1,3]thiazolo[4,5-c][1,5]naphthyridin-5-ium |
| SMILES | CCCCc1nc2c[n+]([O-])c3cccnc3c2s1 |
| InChI | InChI=1S/C13H13N3OS/c1-2-3-6-11-15-9-8-16(17)10-5-4-7-14-12(10)13(9)18-11/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | RTTFUZBPCCCNSV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|