About 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol
5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol (PubChem CID 20633477) has the molecular formula C17H36O2S2
and a molecular weight of 336.61 g/mol. Its IUPAC name is 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol |
| PubChem CID | 20633477 |
| Molecular Formula | C17H36O2S2 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol |
| SMILES | CC(C)(CO)CCCSCCCSCCCC(C)(C)CO |
| InChI | InChI=1S/C17H36O2S2/c1-16(2,14-18)8-5-10-20-12-7-13-21-11-6-9-17(3,4)15-19/h18-19H,5-15H2,1-4H3 |
| InChIKey | WUOAZCNTJJHPHR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol?
The IUPAC name of 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol (CID 20633477) is 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol.
What is the SMILES notation for 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol?
The canonical SMILES for 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol is CC(C)(CO)CCCSCCCSCCCC(C)(C)CO.
What is the InChIKey of 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol?
The InChIKey is WUOAZCNTJJHPHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O2S2/c1-16(2,14-18)8-5-10-20-12-7-13-21-11-6-9-17(3,4)15-19/h18-19H,5-15H2,1-4H3.
What are the key properties of 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol?
5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol has a molecular weight of 336.61 g/mol, XLogP of 4.44, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(5-hydroxy-4,4-dimethylpentyl)sulfanylpropylsulfanyl]-2,2-dimethylpentan-1-ol is sourced from PubChem (CID 20633477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).