C32H40O5S2 — CID 20633568
6-[6-[2-[6-(6-hydroxy-5,5-dimethylhexyl)-4-oxothiopyran-2-yl]phenyl]-4-oxothiopyran-2-yl]-2,2-dimethylhexanoic acid (PubChem CID 20633568) has the molecular formula C32H40O5S2 and a molecular weight of 568.80 g/mol. Its IUPAC name is 6-[6-[2-[6-(6-hydroxy-5,5-dimethylhexyl)-4-oxothiopyran-2-yl]phenyl]-4-oxothiopyran-2-yl]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[6-[2-[6-(6-hydroxy-5,5-dimethylhexyl)-4-oxothiopyran-2-yl]phenyl]-4-oxothiopyran-2-yl]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 20633568 |
| Molecular Formula | C32H40O5S2 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 6-[6-[2-[6-(6-hydroxy-5,5-dimethylhexyl)-4-oxothiopyran-2-yl]phenyl]-4-oxothiopyran-2-yl]-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CO)CCCCc1cc(=O)cc(-c2ccccc2-c2cc(=O)cc(CCCCC(C)(C)C(=O)O)s2)s1 |
| InChI | InChI=1S/C32H40O5S2/c1-31(2,21-33)15-9-7-11-24-17-22(34)19-28(38-24)26-13-5-6-14-27(26)29-20-23(35)18-25(39-29)12-8-10-16-32(3,4)30(36)37/h5-6,13-14,17-20,33H,7-12,15-16,21H2,1-4H3,(H,36,37) |
| InChIKey | JJTFSUTZZJWMTM-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|