About methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate
methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate (PubChem CID 20633622) has the molecular formula C21H40O4S2
and a molecular weight of 420.68 g/mol. Its IUPAC name is methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate.
Molecular Properties
| Compound Name | methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate |
| PubChem CID | 20633622 |
| Molecular Formula | C21H40O4S2 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate |
| SMILES | COC(=O)CC(C)(C)CCCSCCCSCCCC(C)(C)CC(=O)OC |
| InChI | InChI=1S/C21H40O4S2/c1-20(2,16-18(22)24-5)10-7-12-26-14-9-15-27-13-8-11-21(3,4)17-19(23)25-6/h7-17H2,1-6H3 |
| InChIKey | VIDPWRAPAVZEOU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate?
The IUPAC name of methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate (CID 20633622) is methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate.
What is the SMILES notation for methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate?
The canonical SMILES for methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate is COC(=O)CC(C)(C)CCCSCCCSCCCC(C)(C)CC(=O)OC.
What is the InChIKey of methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate?
The InChIKey is VIDPWRAPAVZEOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O4S2/c1-20(2,16-18(22)24-5)10-7-12-26-14-9-15-27-13-8-11-21(3,4)17-19(23)25-6/h7-17H2,1-6H3.
What are the key properties of methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate?
methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate has a molecular weight of 420.68 g/mol, XLogP of 5.58, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[3-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate is sourced from PubChem (CID 20633622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).