C12H18N2O7 — CID 20633846
2-[bis(carboxymethyl)amino]-4-(2-methylprop-2-enoylamino)butanoic acid (PubChem CID 20633846) has the molecular formula C12H18N2O7 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-4-(2-methylprop-2-enoylamino)butanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-4-(2-methylprop-2-enoylamino)butanoic acid |
|---|---|
| PubChem CID | 20633846 |
| Molecular Formula | C12H18N2O7 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-4-(2-methylprop-2-enoylamino)butanoic acid |
| SMILES | C=C(C)C(=O)NCCC(C(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C12H18N2O7/c1-7(2)11(19)13-4-3-8(12(20)21)14(5-9(15)16)6-10(17)18/h8H,1,3-6H2,2H3,(H,13,19)(H,15,16)(H,17,18)(H,20,21) |
| InChIKey | LFNFDHYWNSXWCF-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|