C42H72N2O5 — CID 20633992
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl]propanedioate (PubChem CID 20633992) has the molecular formula C42H72N2O5 and a molecular weight of 685.05 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl]propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl]propanedioate |
|---|---|
| PubChem CID | 20633992 |
| Molecular Formula | C42H72N2O5 |
| Molecular Weight | 685.05 g/mol |
| Exact Mass | 684.54 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl]propanedioate |
| SMILES | CCCCC(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C42H72N2O5/c1-18-19-20-30(27-21-31(37(2,3)4)34(45)32(22-27)38(5,6)7)33(35(46)48-28-23-39(8,9)43(16)40(10,11)24-28)36(47)49-29-25-41(12,13)44(17)42(14,15)26-29/h21-22,28-30,33,45H,18-20,23-26H2,1-17H3 |
| InChIKey | FPLMCQOYXVSLRU-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.05 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|