C19H16F3N5O4S — CID 20634239
3-[3-(1-hydroxy-5-imino-4,4-dimethyl-2-oxopyrrolidin-3-yl)-1,2-benzothiazol-5-yl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 20634239) has the molecular formula C19H16F3N5O4S and a molecular weight of 467.43 g/mol. Its IUPAC name is 3-[3-(1-hydroxy-5-imino-4,4-dimethyl-2-oxopyrrolidin-3-yl)-1,2-benzothiazol-5-yl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[3-(1-hydroxy-5-imino-4,4-dimethyl-2-oxopyrrolidin-3-yl)-1,2-benzothiazol-5-yl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 20634239 |
| Molecular Formula | C19H16F3N5O4S |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 3-[3-(1-hydroxy-5-imino-4,4-dimethyl-2-oxopyrrolidin-3-yl)-1,2-benzothiazol-5-yl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | [H]/N=C1\N(O)C(=O)C(c2nsc3ccc(-n4c(=O)cc(C(F)(F)F)n(C)c4=O)cc23)C1(C)C |
| InChI | InChI=1S/C19H16F3N5O4S/c1-18(2)13(15(29)27(31)16(18)23)14-9-6-8(4-5-10(9)32-24-14)26-12(28)7-11(19(20,21)22)25(3)17(26)30/h4-7,13,23,31H,1-3H3/b23-16- |
| InChIKey | UIJGQHJKBZNXSP-KQWNVCNZSA-N |
| XLogP | 2.48 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|