6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid

C13H13NO2 — CID 2063433

IUPAC6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid
SMILESO=C(O)c1cccc2c3c([nH]c12)CCCC3
InChIInChI=1S/C13H13NO2/c15-13(16)10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h3,5-6,14H,1-2,4,7H2,(H,15,16)
InChIKeyPOBJTDRFZSKTBC-UHFFFAOYSA-N
MW215.25 g/mol
LogP2.74
Rot. Bonds1

About 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid

6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid (PubChem CID 2063433) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid.

Molecular Properties

Compound Name6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid
PubChem CID2063433
Molecular FormulaC13H13NO2
Molecular Weight215.25 g/mol
Exact Mass215.09
IUPAC Name6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid
SMILESO=C(O)c1cccc2c3c([nH]c12)CCCC3
InChIInChI=1S/C13H13NO2/c15-13(16)10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h3,5-6,14H,1-2,4,7H2,(H,15,16)
InChIKeyPOBJTDRFZSKTBC-UHFFFAOYSA-N
XLogP2.74
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 52.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}

Analyze 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid?
The IUPAC name of 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid (CID 2063433) is 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid.
What is the SMILES notation for 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid?
The canonical SMILES for 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid is O=C(O)c1cccc2c3c([nH]c12)CCCC3.
What is the InChIKey of 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid?
The InChIKey is POBJTDRFZSKTBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2/c15-13(16)10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h3,5-6,14H,1-2,4,7H2,(H,15,16).
What are the key properties of 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid?
6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid has a molecular weight of 215.25 g/mol, XLogP of 2.74, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid is sourced from PubChem (CID 2063433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).