C9H4ClF7O2S — CID 2063486
1-chloro-4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)benzene (PubChem CID 2063486) has the molecular formula C9H4ClF7O2S and a molecular weight of 344.64 g/mol. Its IUPAC name is 1-chloro-4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)benzene.
| Compound Name | 1-chloro-4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)benzene |
|---|---|
| PubChem CID | 2063486 |
| Molecular Formula | C9H4ClF7O2S |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 1-chloro-4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)benzene |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4ClF7O2S/c10-5-1-3-6(4-2-5)20(18,19)9(16,17)7(11,12)8(13,14)15/h1-4H |
| InChIKey | ROBJMAPJQZNKML-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|